Products 2138098-18-5
CAS 2138098-18-5 is the registry number for 1-Cyano-5,6,7,8-tetrahydroindolizine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-cyano-5,6,7,8-tetrahydroindolizine-3-carboxylic acid (CAS 2138098-18-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-cyano-5,6,7,8-tetrahydroindolizine-3-carboxylic acid. InChIKey: BCFNCCJWZCAOED-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-cyano-5,6,7,8-tetrahydroindolizine-3-carboxylic acid |
| InChIKey | BCFNCCJWZCAOED-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=C(C=C2C(=O)O)C#N)C1 |
Computed by PubChem (NCBI)