CAS 2138117-78-7 appears in our catalog under these names: (2-Methyl-4-(1H-pyrazol-1-yl)phenyl)methanamine dihydrochloride, 98%, (2-Methyl-4-(1H-pyrazol-1-yl)phenyl)methanamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(2-methyl-4-pyrazol-1-ylphenyl)methanamine;dihydrochloride (CAS 2138117-78-7) is a chemical compound with the molecular formula C11H15Cl2N3 and a molecular weight of 260.16 g/mol. IUPAC name: (2-methyl-4-pyrazol-1-ylphenyl)methanamine;dihydrochloride. InChIKey: AWCFGPRLHHKJTE-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3 |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (2-methyl-4-pyrazol-1-ylphenyl)methanamine;dihydrochloride |
| InChIKey | AWCFGPRLHHKJTE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=CC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)