Products 2138148-96-4
CAS 2138148-96-4 is the registry number for 2-(2-Aminoethyl)-1-benzofuran-6-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-aminoethyl)-1-benzofuran-6-carboxylic acid;hydrochloride (CAS 2138148-96-4) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 2-(2-aminoethyl)-1-benzofuran-6-carboxylic acid;hydrochloride. InChIKey: LSSRIPDBLPIHGO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 2-(2-aminoethyl)-1-benzofuran-6-carboxylic acid;hydrochloride |
| InChIKey | LSSRIPDBLPIHGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=C2)CCN.Cl |
Computed by PubChem (NCBI)