Products 2138226-81-8
CAS 2138226-81-8 is the registry number for Methyl 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylate (CAS 2138226-81-8) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: methyl 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylate. InChIKey: YYYYDILHPWCHML-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | methyl 5-amino-3-tert-butyl-1,2-thiazole-4-carboxylate |
| InChIKey | YYYYDILHPWCHML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NSC(=C1C(=O)OC)N |
Computed by PubChem (NCBI)