Products 2138518-29-1

CAS 2138518-29-1 is the registry number for 3-Amino-4-chloro-5-methoxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride (CAS 2138518-29-1) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: 3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride. InChIKey: LUQOPFPGGLKLHM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Cl2NO3
Molecular weight238.06 g/mol
IUPAC name3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride
InChIKeyLUQOPFPGGLKLHM-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1Cl)N)C(=O)O.Cl

Computed by PubChem (NCBI)