CAS 2138518-29-1 is the registry number for 3-Amino-4-chloro-5-methoxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride (CAS 2138518-29-1) is a chemical compound with the molecular formula C8H9Cl2NO3 and a molecular weight of 238.06 g/mol. IUPAC name: 3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride. InChIKey: LUQOPFPGGLKLHM-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 3-amino-4-chloro-5-methoxybenzoic acid;hydrochloride |
| InChIKey | LUQOPFPGGLKLHM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Cl)N)C(=O)O.Cl |
Computed by PubChem (NCBI)