CAS 214261-65-1 is the registry number for 4-Bromo-N-(2,2,2-trifluoroethyl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-N-(2,2,2-trifluoroethyl)benzamide (CAS 214261-65-1) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: 4-bromo-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: LQZGTGRBYQARBF-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | 4-bromo-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | LQZGTGRBYQARBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(F)(F)F)Br |
Computed by PubChem (NCBI)