CAS 21440-96-0 appears in our catalog under these names: 4,4-Dimethyl-1H-3,1-benzoxazin-2-one, 95%, 4,4-Dimethyl-1H-benzo(d)(1,3)oxazin-2(4H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 21440-96-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: DXRDETPOBPURRD-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | DXRDETPOBPURRD-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2NC(=O)O1)C |
Computed by PubChem (NCBI)