Products 2146077-43-0
CAS 2146077-43-0 is the registry number for Benzyl 3-sulfamoylpiperidine-1-carboxylate, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Benzyl 3-sulfamoylpiperidine-1-carboxylate (CAS 2146077-43-0) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: benzyl 3-sulfamoylpiperidine-1-carboxylate. InChIKey: BVCHEDSLMLHTAL-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | benzyl 3-sulfamoylpiperidine-1-carboxylate |
| InChIKey | BVCHEDSLMLHTAL-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)