Products 2147-26-4
CAS 2147-26-4 appears in our catalog under these names: Phenyl 4-pyridinyl ketone oxime, 95%, (Z)–Phenyl(pyridin–4–yl)methanone oxime, (Z)-Phenyl(pyridin-4-yl)methanone oxime, 95%. Offered by: Chemat, GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 25mg, 100mg, 1g, 250mg, 5g.
(NZ)-N-[phenyl(pyridin-4-yl)methylidene]hydroxylamine (CAS 2147-26-4) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: (NZ)-N-[phenyl(pyridin-4-yl)methylidene]hydroxylamine. InChIKey: SNRZFINAACEZKZ-OWBHPGMISA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (NZ)-N-[phenyl(pyridin-4-yl)methylidene]hydroxylamine |
| InChIKey | SNRZFINAACEZKZ-OWBHPGMISA-N |
| SMILES | C1=CC=C(C=C1)/C(=N/O)/C2=CC=NC=C2 |
Computed by PubChem (NCBI)