Products 2147-61-7

CAS 2147-61-7 is the registry number for 3-Hydroxy-DL-kynurenine, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg.

Structural formula: {0} (CAS {1})

3-hydroxykynurenine is a hydroxykynurenine that is kynurenine substituted by a hydroxy group at position 3. It has a role as a human metabolite.

Source: ChEBI

Identity
Molecular formulaC10H12N2O4
Molecular weight224.21 g/mol
IUPAC name2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid
InChIKeyVCKPUUFAIGNJHC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)O)N)C(=O)CC(C(=O)O)N

Computed by PubChem (NCBI)