CAS 2147-61-7 is the registry number for 3-Hydroxy-DL-kynurenine, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg.
3-hydroxykynurenine is a hydroxykynurenine that is kynurenine substituted by a hydroxy group at position 3. It has a role as a human metabolite.
Source: ChEBI
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid |
| InChIKey | VCKPUUFAIGNJHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)C(=O)CC(C(=O)O)N |
Computed by PubChem (NCBI)