Products 2267306-16-9
CAS 2267306-16-9 appears in our catalog under these names: 3–Hydroxykynurenine–13C3,15N, 3-Hydroxykynurenine-13C3,15N, 98.74%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-(2-amino-3-hydroxyphenyl)-2-(15N)azanyl-4-oxo(1,2,3-13C3)butanoic acid (CAS 2267306-16-9) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 228.18 g/mol. IUPAC name: 4-(2-amino-3-hydroxyphenyl)-2-(15N)azanyl-4-oxo(1,2,3-13C3)butanoic acid. InChIKey: VCKPUUFAIGNJHC-IUPFVMHNSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 4-(2-amino-3-hydroxyphenyl)-2-(15N)azanyl-4-oxo(1,2,3-13C3)butanoic acid |
| InChIKey | VCKPUUFAIGNJHC-IUPFVMHNSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)C(=O)[13CH2][13CH]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)