CAS 214896-04-5 is the registry number for 4-Vinyl-1,3-phenylene diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-acetyloxy-4-ethenylphenyl) acetate (CAS 214896-04-5) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (3-acetyloxy-4-ethenylphenyl) acetate. InChIKey: GRVVNJVEESPUML-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3-acetyloxy-4-ethenylphenyl) acetate |
| InChIKey | GRVVNJVEESPUML-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)C=C)OC(=O)C |
Computed by PubChem (NCBI)