Products 214896-04-5

CAS 214896-04-5 is the registry number for 4-Vinyl-1,3-phenylene diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-acetyloxy-4-ethenylphenyl) acetate (CAS 214896-04-5) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (3-acetyloxy-4-ethenylphenyl) acetate. InChIKey: GRVVNJVEESPUML-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O4
Molecular weight220.22 g/mol
IUPAC name(3-acetyloxy-4-ethenylphenyl) acetate
InChIKeyGRVVNJVEESPUML-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC(=C(C=C1)C=C)OC(=O)C

Computed by PubChem (NCBI)