CAS 905710-55-6 appears in our catalog under these names: 6-Fluoro-3,4-dihydro-1H-2,1-benzoxaborinin-1-ol, 95%, 6-Fluoro-3,4-dihydro-1H-2,1-benzoxaborinin-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-fluoro-1-hydroxy-3,4-dihydro-2,1-benzoxaborinine (CAS 905710-55-6) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: 6-fluoro-1-hydroxy-3,4-dihydro-2,1-benzoxaborinine. InChIKey: OBHRHSYGQBYLNH-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | 6-fluoro-1-hydroxy-3,4-dihydro-2,1-benzoxaborinine |
| InChIKey | OBHRHSYGQBYLNH-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CCO1)C=C(C=C2)F)O |
Computed by PubChem (NCBI)