CAS 2739832-10-9 appears in our catalog under these names: (R)-5-Fluoro-3-methylbenzo[c][1,2]oxaborol-1(3H)-ol, 95%, (R)-5-Fluoro-3-methylbenzo[c][1,2]oxaborol-1(3H)-ol 98%, (R)-5-Fluoro-3-methylbenzo[c][1,2]oxaborol-1(3H)-ol, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
(3R)-5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole (CAS 2739832-10-9) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: (3R)-5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole. InChIKey: LWINTJPRLPNUPE-RXMQYKEDSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | (3R)-5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole |
| InChIKey | LWINTJPRLPNUPE-RXMQYKEDSA-N |
| SMILES | B1(C2=C(C=C(C=C2)F)[C@H](O1)C)O |
Computed by PubChem (NCBI)