CAS 905710-75-0 appears in our catalog under these names: 5-Fluoro-3-methylbenzo[c][1,2]oxaborol-1(3H)-ol, 98%, 98%, 5-Fluoro-3-methylbenzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole (CAS 905710-75-0) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: 5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole. InChIKey: LWINTJPRLPNUPE-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | 5-fluoro-1-hydroxy-3-methyl-3H-2,1-benzoxaborole |
| InChIKey | LWINTJPRLPNUPE-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=C(C=C2)F)C(O1)C)O |
Computed by PubChem (NCBI)