Products 2155855-34-6
CAS 2155855-34-6 appears in our catalog under these names: 1–(3,5–Dimethylphenyl)propan–1–amine hydrochloride, 1-(3,5-Dimethylphenyl)propan-1-amine hydrochloride, 1-(3,5-Dimethylphenyl)propan-1-amine hydrochloride, 97%, 97%. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
1-(3,5-dimethylphenyl)propan-1-amine;hydrochloride (CAS 2155855-34-6) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)propan-1-amine;hydrochloride. InChIKey: BYBJHENTQXYVQD-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)propan-1-amine;hydrochloride |
| InChIKey | BYBJHENTQXYVQD-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC(=C1)C)C)N.Cl |
Computed by PubChem (NCBI)