CAS 215918-39-1 is the registry number for tert-Butyl (2S,4S)-2-(hydroxymethyl)-4-methoxypyrrolidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methoxypyrrolidine-1-carboxylate (CAS 215918-39-1) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methoxypyrrolidine-1-carboxylate. InChIKey: ZYVBYRKLECISLP-IUCAKERBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-methoxypyrrolidine-1-carboxylate |
| InChIKey | ZYVBYRKLECISLP-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1CO)OC |
Computed by PubChem (NCBI)