CAS 21650-65-7 is the registry number for (E)-1,2-Diphenyldiazene 1-oxide, 97%. Offered by: AmBeed. Available pack sizes: 100g.
Oxido-phenyl-phenyliminoazanium (CAS 21650-65-7) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: oxido-phenyl-phenyliminoazanium. InChIKey: GAUZCKBSTZFWCT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | oxido-phenyl-phenyliminoazanium |
| InChIKey | GAUZCKBSTZFWCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=[N+](C2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)