Products 2165340-32-7
CAS 2165340-32-7 appears in our catalog under these names: CU-CPT-9a/ 98%, CU–CPT–9a, CU-CPT9a, CU-CPT-9a, 99.74%, CU-CPT-9a, 98%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
4-(7-methoxyquinolin-4-yl)-2-methylphenol (CAS 2165340-32-7) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 4-(7-methoxyquinolin-4-yl)-2-methylphenol. InChIKey: HNYBTVKYLVLWCB-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 4-(7-methoxyquinolin-4-yl)-2-methylphenol |
| InChIKey | HNYBTVKYLVLWCB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=C3C=CC(=CC3=NC=C2)OC)O |
Computed by PubChem (NCBI)