Products 2165347-53-3
CAS 2165347-53-3 is the registry number for Benzyl tert-butyl bicyclo[1.1.1]pentane-1,3-diyldicarbamate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Benzyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 2165347-53-3) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: benzyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: OTKBTQQVMWTIAZ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | benzyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | OTKBTQQVMWTIAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)