CAS 2165432-64-2 appears in our catalog under these names: (S)-1-(tert-Butoxycarbonyl)-2,2-dimethylpiperidine-4-carboxylic acid, 97%, 97%, (S)-1-(TERT-BUTOXYCARBONYL)-2,2-DIMETHYLPIPERIDINE-4-CARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(4S)-2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 2165432-64-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (4S)-2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: PPHAJUZQLQVZDA-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (4S)-2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | PPHAJUZQLQVZDA-VIFPVBQESA-N |
| SMILES | CC1(C[C@H](CCN1C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)