CAS 2165554-86-7 appears in our catalog under these names: (2S,4S)-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-2-carboxylic acid, 98%, rac-(2R,4R)-4-{[(tert-butoxy)carbonyl]amino}oxolane-2-carboxylicacid, >97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid (CAS 2165554-86-7) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid. InChIKey: XPLRZNDPTQWMSL-BQBZGAKWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid |
| InChIKey | XPLRZNDPTQWMSL-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](OC1)C(=O)O |
Computed by PubChem (NCBI)