CAS 489446-83-5 is the registry number for (2R,4S)-4-((tert-Butoxycarbonyl)amino)tetrahydrofuran-2-carboxylic acid, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid (CAS 489446-83-5) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid. InChIKey: XPLRZNDPTQWMSL-NKWVEPMBSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxolane-2-carboxylic acid |
| InChIKey | XPLRZNDPTQWMSL-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](OC1)C(=O)O |
Computed by PubChem (NCBI)