Products 2166044-53-5
CAS 2166044-53-5 is the registry number for 1-(tert-Butyl) 4-methyl (S)-3-amino-2,2-dimethylsuccinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-methyl (3S)-3-amino-2,2-dimethylbutanedioate (CAS 2166044-53-5) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3S)-3-amino-2,2-dimethylbutanedioate. InChIKey: YYBVENSPAHNPKB-SSDOTTSWSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (3S)-3-amino-2,2-dimethylbutanedioate |
| InChIKey | YYBVENSPAHNPKB-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C)[C@@H](C(=O)OC)N |
Computed by PubChem (NCBI)