Products 2166199-20-6
CAS 2166199-20-6 is the registry number for 1-(alpha-L-Threofuranosyl)cytosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (CAS 2166199-20-6) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one. InChIKey: RPXKLKGKUUDJFW-UBKIQSJTSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| InChIKey | RPXKLKGKUUDJFW-UBKIQSJTSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)N)O)O |
Computed by PubChem (NCBI)