Products 2167002-19-7
CAS 2167002-19-7 is the registry number for 4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2167002-19-7) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: SDNCXHWVQSCSRW-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | SDNCXHWVQSCSRW-UHFFFAOYSA-N |
| SMILES | C1C2C(C1(CO2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)