CAS 2759497-30-6 appears in our catalog under these names: rel-(1R,4S,5S)-4-Phenyl-2-oxabicyclo(2.1.1)hexane-5-carboxylic acid, 95%, rac-(1R,4S,5S)-4-Phenyl-2-oxabicyclo(2.1.1)hexane-5-carboxylic acid, rel-(1R,4S,5S)-4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,005g, 0,01g, 0,025g, 100mg, 250mg, 500mg.
(1R,4S,5S)-4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2759497-30-6) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: (1R,4S,5S)-4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: SDNCXHWVQSCSRW-JFGNBEQYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (1R,4S,5S)-4-phenyl-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | SDNCXHWVQSCSRW-JFGNBEQYSA-N |
| SMILES | C1[C@@H]2[C@H]([C@]1(CO2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)