Products 2167496-52-6
CAS 2167496-52-6 is the registry number for 1-(Furan-2-yl)bicyclo(2.1.1)hexane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(furan-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2167496-52-6) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(furan-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: LYWKPQUHILRBEF-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(furan-2-yl)bicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | LYWKPQUHILRBEF-UHFFFAOYSA-N |
| SMILES | C1CC2(CC1C2C(=O)O)C3=CC=CO3 |
Computed by PubChem (NCBI)