Products 2167971-19-7

CAS 2167971-19-7 is the registry number for 4-(Difluoromethyl)-5-fluoro-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(difluoromethyl)-5-fluoro-1H-indole-2-carboxylic acid (CAS 2167971-19-7) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: 4-(difluoromethyl)-5-fluoro-1H-indole-2-carboxylic acid. InChIKey: IGDIGZZGTZLBTK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F3NO2
Molecular weight229.15 g/mol
IUPAC name4-(difluoromethyl)-5-fluoro-1H-indole-2-carboxylic acid
InChIKeyIGDIGZZGTZLBTK-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1NC(=C2)C(=O)O)C(F)F)F

Computed by PubChem (NCBI)