Products 2168071-52-9
CAS 2168071-52-9 is the registry number for 2-(6-(Difluoromethoxy)pyridin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[6-(difluoromethoxy)-2-pyridinyl]acetic acid (CAS 2168071-52-9) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2-[6-(difluoromethoxy)-2-pyridinyl]acetic acid. InChIKey: BZYSVCRTEQWOIG-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-[6-(difluoromethoxy)-2-pyridinyl]acetic acid |
| InChIKey | BZYSVCRTEQWOIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OC(F)F)CC(=O)O |
Computed by PubChem (NCBI)