Products 2168125-49-1

CAS 2168125-49-1 is the registry number for 1-tert-Butyl 2-ethyl 3-oxoazetidine-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-ethyl 3-oxoazetidine-1,2-dicarboxylate (CAS 2168125-49-1) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 3-oxoazetidine-1,2-dicarboxylate. InChIKey: PRPGKVWGWIPRIX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO5
Molecular weight243.26 g/mol
IUPAC name1-O-tert-butyl 2-O-ethyl 3-oxoazetidine-1,2-dicarboxylate
InChIKeyPRPGKVWGWIPRIX-UHFFFAOYSA-N
SMILESCCOC(=O)C1C(=O)CN1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)