Products 21683-86-3
CAS 21683-86-3 appears in our catalog under these names: 3-(Benzofuran-2-yl)propanoic acid, 97%, 3-(1-benzofuran-2-yl)propanoic acid, 3-(1-Benzofuran-2-yl)propanoic acid, 95%, 3-(1-Benzofuran-2-yl)propanoic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg, 10g.
3-(1-benzofuran-2-yl)propanoic acid (CAS 21683-86-3) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 3-(1-benzofuran-2-yl)propanoic acid. InChIKey: RSCSQNQHINMHDE-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-(1-benzofuran-2-yl)propanoic acid |
| InChIKey | RSCSQNQHINMHDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)