Products 2168559-67-7
CAS 2168559-67-7 appears in our catalog under these names: 2–Chloro–4–ethynylbenzoic acid, 2-Chloro-4-ethynylbenzoic acid 97%, Benzoic acid, 2-chloro-4-ethynyl-, 98%, 98%, 2-Chloro-4-ethynylbenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-4-ethynylbenzoic acid (CAS 2168559-67-7) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 2-chloro-4-ethynylbenzoic acid. InChIKey: RUAVYSBZAHLZNH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-chloro-4-ethynylbenzoic acid |
| InChIKey | RUAVYSBZAHLZNH-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)