CAS 2168799-10-6 is the registry number for 6-Cyclopropyl-4-methylpyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-cyclopropyl-4-methylpyridine-3-carboxylic acid (CAS 2168799-10-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-cyclopropyl-4-methylpyridine-3-carboxylic acid. InChIKey: XJCBKBRXNFHFJZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-cyclopropyl-4-methylpyridine-3-carboxylic acid |
| InChIKey | XJCBKBRXNFHFJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1C(=O)O)C2CC2 |
Computed by PubChem (NCBI)