Products 2168799-10-6

CAS 2168799-10-6 is the registry number for 6-Cyclopropyl-4-methylpyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-cyclopropyl-4-methylpyridine-3-carboxylic acid (CAS 2168799-10-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-cyclopropyl-4-methylpyridine-3-carboxylic acid. InChIKey: XJCBKBRXNFHFJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO2
Molecular weight177.20 g/mol
IUPAC name6-cyclopropyl-4-methylpyridine-3-carboxylic acid
InChIKeyXJCBKBRXNFHFJZ-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1C(=O)O)C2CC2

Computed by PubChem (NCBI)