CAS 2168814-75-1 appears in our catalog under these names: 6-Bromo-2-ethoxy-1h-benzo[d][1,3]oxazin-4(2h)-one, 95%, 6-BROMO-2-ETHOXY-1H-BENZO(D)(1,3)OXAZIN-4(2H)-ONE, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-bromo-2-ethoxy-1,2-dihydro-3,1-benzoxazin-4-one (CAS 2168814-75-1) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: 6-bromo-2-ethoxy-1,2-dihydro-3,1-benzoxazin-4-one. InChIKey: YUCIKEKYMSGSRY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 6-bromo-2-ethoxy-1,2-dihydro-3,1-benzoxazin-4-one |
| InChIKey | YUCIKEKYMSGSRY-UHFFFAOYSA-N |
| SMILES | CCOC1NC2=C(C=C(C=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)