CAS 216956-20-6 is the registry number for 5-(3'-Hydroxybenzyl)hydantoin. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
5-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione (CAS 216956-20-6) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 5-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione. InChIKey: SIDWPXBEWSODDF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 5-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione |
| InChIKey | SIDWPXBEWSODDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CC2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)