Products 2169921-92-8
CAS 2169921-92-8 is the registry number for Methyl 5-sulfamoyl-2,3-dihydro-1H-indene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 5-sulfamoyl-2,3-dihydro-1H-indene-2-carboxylate (CAS 2169921-92-8) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: methyl 5-sulfamoyl-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: QYSDAVNQJWRODS-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | methyl 5-sulfamoyl-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | QYSDAVNQJWRODS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C1)C=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)