Products 21711-49-9
CAS 21711-49-9 is the registry number for 2-Chloro-1,1':4',1''-terphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-2-(4-phenylphenyl)benzene (CAS 21711-49-9) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 1-chloro-2-(4-phenylphenyl)benzene. InChIKey: VSQVHSQDYOPSRI-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl |
|---|---|
| Molecular weight | 264.7 g/mol |
| IUPAC name | 1-chloro-2-(4-phenylphenyl)benzene |
| InChIKey | VSQVHSQDYOPSRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)