CAS 98905-05-6 appears in our catalog under these names: 2'-Chloro-1,1':4',1''-terphenyl, 98%, 2,5-Diphenylchlorobenzene, 95%, 95%, 2'-Chloro-1,1':4',1''-terphenyl, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-chloro-1,4-diphenylbenzene (CAS 98905-05-6) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 2-chloro-1,4-diphenylbenzene. InChIKey: NKHQYWROIURKKP-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl |
|---|---|
| Molecular weight | 264.7 g/mol |
| IUPAC name | 2-chloro-1,4-diphenylbenzene |
| InChIKey | NKHQYWROIURKKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)