CAS 126866-34-0 appears in our catalog under these names: 5'-Chloro-1,1':3',1''-terphenyl, 95%, 5'-Chloro-1,1':3',1''-terphenyl, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
1-chloro-3,5-diphenylbenzene (CAS 126866-34-0) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 1-chloro-3,5-diphenylbenzene. InChIKey: JYJKHXKJEGJOPV-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl |
|---|---|
| Molecular weight | 264.7 g/mol |
| IUPAC name | 1-chloro-3,5-diphenylbenzene |
| InChIKey | JYJKHXKJEGJOPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)