CAS 1762-83-0 is the registry number for 4-Chloro-1,1':4',1''-terphenyl. Offered by: TRC. Available pack sizes: 10mg.
1-chloro-4-(4-phenylphenyl)benzene (CAS 1762-83-0) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 1-chloro-4-(4-phenylphenyl)benzene. InChIKey: JQRLWSKBKUFWID-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl |
|---|---|
| Molecular weight | 264.7 g/mol |
| IUPAC name | 1-chloro-4-(4-phenylphenyl)benzene |
| InChIKey | JQRLWSKBKUFWID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)