CAS 21711-54-6 appears in our catalog under these names: 4-Chloro-1,1':2',1''-terphenyl, 98%, 4–Chloro–1,1':2',1''–terphenyl, 4-Chloro-1,1':2',1''-terphenyl, 99%, 99%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 25g, 100g.
1-chloro-4-(2-phenylphenyl)benzene (CAS 21711-54-6) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 1-chloro-4-(2-phenylphenyl)benzene. InChIKey: LISOOWANSPLUPV-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl |
|---|---|
| Molecular weight | 264.7 g/mol |
| IUPAC name | 1-chloro-4-(2-phenylphenyl)benzene |
| InChIKey | LISOOWANSPLUPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)