Products 98781-25-0

CAS 98781-25-0 is the registry number for 3-Chloro-1,1':3',1''-terphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-chloro-3-(3-phenylphenyl)benzene (CAS 98781-25-0) is a chemical compound with the molecular formula C18H13Cl and a molecular weight of 264.7 g/mol. IUPAC name: 1-chloro-3-(3-phenylphenyl)benzene. InChIKey: FLGLFUIDRYWVDL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13Cl
Molecular weight264.7 g/mol
IUPAC name1-chloro-3-(3-phenylphenyl)benzene
InChIKeyFLGLFUIDRYWVDL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC(=CC=C3)Cl

Computed by PubChem (NCBI)