Products 21715-41-3
CAS 21715-41-3 is the registry number for N-(4-Chloro-2-(1-hydroxy-1-phenylethyl)phenyl)-urea. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
[4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]urea (CAS 21715-41-3) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: [4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]urea. InChIKey: YFGLQHUZRGYRNZ-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | [4-chloro-2-(1-hydroxy-1-phenylethyl)phenyl]urea |
| InChIKey | YFGLQHUZRGYRNZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=C(C=CC(=C2)Cl)NC(=O)N)O |
Computed by PubChem (NCBI)