Products 2171904-64-4
CAS 2171904-64-4 is the registry number for 4,7-Dimethyl-1H,2H,3H,4H-pyrido(2,3-b)pyrazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,7-dimethyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine;dihydrochloride (CAS 2171904-64-4) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 4,7-dimethyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine;dihydrochloride. InChIKey: QKDRTNBRYLOMEK-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 4,7-dimethyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazine;dihydrochloride |
| InChIKey | QKDRTNBRYLOMEK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)N(CCN2)C.Cl.Cl |
Computed by PubChem (NCBI)