Products 2171906-43-5

CAS 2171906-43-5 is the registry number for 1-(3-Aminophenyl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2171906-43-5) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: QTNSDFASTNGYPV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2
Molecular weight227.69 g/mol
IUPAC name1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride
InChIKeyQTNSDFASTNGYPV-UHFFFAOYSA-N
SMILESC1CC(C1)(C2=CC(=CC=C2)N)C(=O)O.Cl

Computed by PubChem (NCBI)