CAS 2171906-43-5 is the registry number for 1-(3-Aminophenyl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2171906-43-5) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: QTNSDFASTNGYPV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 1-(3-aminophenyl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | QTNSDFASTNGYPV-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)