Products 2172184-17-5
CAS 2172184-17-5 is the registry number for tert-Butyl 4-imino-1H,4H,7H-pyrrolo(2,3-d)pyrimidine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 4-amino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate (CAS 2172184-17-5) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: tert-butyl 4-amino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate. InChIKey: IODHEPNYPFJCGI-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | tert-butyl 4-amino-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | IODHEPNYPFJCGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(N=CN=C2N1)N |
Computed by PubChem (NCBI)