CAS 2172518-36-2 is the registry number for Methyl 7-amino-1-oxo-2,3-dihydro-1H-isoindole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 7-amino-1-oxo-2,3-dihydroisoindole-4-carboxylate (CAS 2172518-36-2) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: methyl 7-amino-1-oxo-2,3-dihydroisoindole-4-carboxylate. InChIKey: SHGKDGVPIPQLSQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | methyl 7-amino-1-oxo-2,3-dihydroisoindole-4-carboxylate |
| InChIKey | SHGKDGVPIPQLSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CNC(=O)C2=C(C=C1)N |
Computed by PubChem (NCBI)