Products 2172536-86-4
CAS 2172536-86-4 is the registry number for Methyl 3-(4-hydroxyphenyl)-3-methoxycyclobutane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-(4-hydroxyphenyl)-3-methoxycyclobutane-1-carboxylate (CAS 2172536-86-4) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: methyl 3-(4-hydroxyphenyl)-3-methoxycyclobutane-1-carboxylate. InChIKey: SAEGLCYBHPJNJD-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | methyl 3-(4-hydroxyphenyl)-3-methoxycyclobutane-1-carboxylate |
| InChIKey | SAEGLCYBHPJNJD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)(C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)