CAS 2172570-04-4 is the registry number for 3-Cyclopropyl-3H,6H,7H-(1,2,3)triazolo(4,5-d)pyrimidin-7-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-cyclopropyl-6H-triazolo[4,5-d]pyrimidin-7-one (CAS 2172570-04-4) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: 3-cyclopropyl-6H-triazolo[4,5-d]pyrimidin-7-one. InChIKey: WRUOVYUXYYFRIO-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-cyclopropyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| InChIKey | WRUOVYUXYYFRIO-UHFFFAOYSA-N |
| SMILES | C1CC1N2C3=C(C(=O)NC=N3)N=N2 |
Computed by PubChem (NCBI)